Products 1609553-33-4
CAS 1609553-33-4 is the registry number for (2S,4S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-4-allylpyrrol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-prop-2-enylpyrrolidine-2-carboxylic acid (CAS 1609553-33-4) is a chemical compound with the molecular formula C23H23NO4 and a molecular weight of 377.4 g/mol. IUPAC name: (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-prop-2-enylpyrrolidine-2-carboxylic acid. InChIKey: HCTIBKWJQNADEQ-BTYIYWSLSA-N.
| Molecular formula | C23H23NO4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-prop-2-enylpyrrolidine-2-carboxylic acid |
| InChIKey | HCTIBKWJQNADEQ-BTYIYWSLSA-N |
| SMILES | C=CC[C@H]1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)