Products 87745-55-9

CAS 87745-55-9 is the registry number for N-Benzyloxycarbonyl-4-O-benzyl Dopamine. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.

Structural formula: {0} (CAS {1})

Benzyl N-[2-(3-hydroxy-4-phenylmethoxyphenyl)ethyl]carbamate (CAS 87745-55-9) is a chemical compound with the molecular formula C23H23NO4 and a molecular weight of 377.4 g/mol. IUPAC name: benzyl N-[2-(3-hydroxy-4-phenylmethoxyphenyl)ethyl]carbamate. InChIKey: GSEDVGWVNCVJCK-UHFFFAOYSA-N.

Identity
Molecular formulaC23H23NO4
Molecular weight377.4 g/mol
IUPAC namebenzyl N-[2-(3-hydroxy-4-phenylmethoxyphenyl)ethyl]carbamate
InChIKeyGSEDVGWVNCVJCK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=C(C=C2)CCNC(=O)OCC3=CC=CC=C3)O

Computed by PubChem (NCBI)