CAS 1257856-10-2 appears in our catalog under these names: FMOC-5-CHLORO-D-TRYPTOPHAN, ≥98%, ≥98%, Fmoc-D-Trp(5-Cl)-OH, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g.
(2R)-3-(5-chloro-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1257856-10-2) is a chemical compound with the molecular formula C26H21ClN2O4 and a molecular weight of 460.9 g/mol. IUPAC name: (2R)-3-(5-chloro-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ZRVDPQCSRZAYPG-XMMPIXPASA-N.
| Molecular formula | C26H21ClN2O4 |
|---|---|
| Molecular weight | 460.9 g/mol |
| IUPAC name | (2R)-3-(5-chloro-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ZRVDPQCSRZAYPG-XMMPIXPASA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CNC5=C4C=C(C=C5)Cl)C(=O)O |
Computed by PubChem (NCBI)