CAS 2244532-68-9 appears in our catalog under these names: Fmoc-Trp(4-Cl)-OH 95%, 4-Chloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- L-tryptophan, >95%, >95%, Fmoc-L-Trp(4-Cl)-OH, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2S)-3-(4-chloro-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2244532-68-9) is a chemical compound with the molecular formula C26H21ClN2O4 and a molecular weight of 460.9 g/mol. IUPAC name: (2S)-3-(4-chloro-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: XRXGWEBMYWNTCH-QHCPKHFHSA-N.
| Molecular formula | C26H21ClN2O4 |
|---|---|
| Molecular weight | 460.9 g/mol |
| IUPAC name | (2S)-3-(4-chloro-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | XRXGWEBMYWNTCH-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=C4C(=CC=C5)Cl)C(=O)O |
Computed by PubChem (NCBI)