CAS 925916-73-0 appears in our catalog under these names: Fmoc-6-chloro D-Tryptophan, Fmoc-D-Trp(6-Cl)-OH 98%, Fmoc-6-chloro-D-tryptophan, 95%, 95%, Fmoc-6-chloro D-Tryptophan, 95%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg.
(2R)-3-(6-chloro-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 925916-73-0) is a chemical compound with the molecular formula C26H21ClN2O4 and a molecular weight of 460.9 g/mol. IUPAC name: (2R)-3-(6-chloro-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: FDXGPPBWOOAVEL-XMMPIXPASA-N.
| Molecular formula | C26H21ClN2O4 |
|---|---|
| Molecular weight | 460.9 g/mol |
| IUPAC name | (2R)-3-(6-chloro-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | FDXGPPBWOOAVEL-XMMPIXPASA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CNC5=C4C=CC(=C5)Cl)C(=O)O |
Computed by PubChem (NCBI)