cas: 162502-65-0 — see every product listed under this CAS number, including other names
Fmoc-D-Tyr(4-Et)-OH, 98% (CAS 162502-65-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M06101-1G |
| cas | 162502-65-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 221.81 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 100g | 1294.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2R)-3-(4-ethoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 162502-65-0) is a chemical compound with the molecular formula C26H25NO5 and a molecular weight of 431.5 g/mol. IUPAC name: (2R)-3-(4-ethoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: XUKUVROJKPSLLU-XMMPIXPASA-N.
| Molecular formula | C26H25NO5 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (2R)-3-(4-ethoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | XUKUVROJKPSLLU-XMMPIXPASA-N |
| SMILES | CCOC1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)