Fmoc-D-Tyr(Et)-OH 97%
cas: 162502-65-0 — see every product listed under this CAS number, including other names
Fmoc-D-Tyr(Et)-OH 97% (CAS 162502-65-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A323052-250mg |
| cas | 162502-65-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 409.31 Pln | |
| Ambeed | 100g | 1288.19 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A323052 |
(2R)-3-(4-ethoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 162502-65-0) is a chemical compound with the molecular formula C26H25NO5 and a molecular weight of 431.5 g/mol. IUPAC name: (2R)-3-(4-ethoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: XUKUVROJKPSLLU-XMMPIXPASA-N.
| Molecular formula | C26H25NO5 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (2R)-3-(4-ethoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | XUKUVROJKPSLLU-XMMPIXPASA-N |
| SMILES | CCOC1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-D-Tyr(4-Et)-OH, Fmoc-O-ethyl-D-tyrosine, Fmoc-D-Tyr(Et)-OH, (2R)-3-(4-ethoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid, D-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, Fmoc-4-ethoxy-D-Phe-OH, O-Ethyl-N-Fmoc-D-tyrosine, O-Ethyl-N-{[(9H-fluoren-9-yl)methoxy]carbonyl}-D-tyrosine