cas: 144120-54-7 — see every product listed under this CAS number, including other names
Fmoc-Glu-OAll, 97% (CAS 144120-54-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A178277-1g |
| cas | 144120-54-7 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 325.88 Pln | |
| Ambeed | 100g | 1049.00 Pln | |
| Ambeed | 500g | 4920.50 Pln | |
| Ambeed | 1kg | 8130.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid (CAS 144120-54-7) is a chemical compound with the molecular formula C23H23NO6 and a molecular weight of 409.4 g/mol. IUPAC name: (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid. InChIKey: ORKKMGRINLTBPC-FQEVSTJZSA-N.
| Molecular formula | C23H23NO6 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid |
| InChIKey | ORKKMGRINLTBPC-FQEVSTJZSA-N |
| SMILES | C=CCOC(=O)[C@H](CCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)