Products 366491-50-1

CAS 366491-50-1 is the registry number for Fmoc-dl-glu(oall)-oh, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid (CAS 366491-50-1) is a chemical compound with the molecular formula C23H23NO6 and a molecular weight of 409.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid. InChIKey: LRBARFFNYOKIAX-UHFFFAOYSA-N.

Identity
Molecular formulaC23H23NO6
Molecular weight409.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid
InChIKeyLRBARFFNYOKIAX-UHFFFAOYSA-N
SMILESC=CCOC(=O)CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)