CAS 2298323-86-9 is the registry number for (S)-2-[[[(9H-Fluoren-9-yl)methoxy]carbonyl](methyl)amino]-4-(allyloxy)-4-oxobutanoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50g, 100g, 250g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-4-prop-2-enoxybutanoic acid (CAS 2298323-86-9) is a chemical compound with the molecular formula C23H23NO6 and a molecular weight of 409.4 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-4-prop-2-enoxybutanoic acid. InChIKey: HTDWMNDUFNXBIA-FQEVSTJZSA-N.
| Molecular formula | C23H23NO6 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-4-prop-2-enoxybutanoic acid |
| InChIKey | HTDWMNDUFNXBIA-FQEVSTJZSA-N |
| SMILES | CN([C@@H](CC(=O)OCC=C)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)