cas: 105496-31-9 — see every product listed under this CAS number, including other names
Fmoc-Glycinol 98% (CAS 105496-31-9) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A231712-1000g |
| cas | 105496-31-9 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2250.50 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 181.25 Pln | |
| Ambeed | 100g | 464.94 Pln | |
| Ambeed | 500g | 1432.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A231712 |
9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)carbamate (CAS 105496-31-9) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)carbamate. InChIKey: XLIFWDZVNRWYKV-UHFFFAOYSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)carbamate |
| InChIKey | XLIFWDZVNRWYKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCO |
Computed by PubChem (NCBI)