Products 1820718-00-0
CAS 1820718-00-0 is the registry number for methyl 2-{4-[3-(methylcarbamoyl)phenyl]phenyl}acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-[4-[3-(methylcarbamoyl)phenyl]phenyl]acetate (CAS 1820718-00-0) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: methyl 2-[4-[3-(methylcarbamoyl)phenyl]phenyl]acetate. InChIKey: OCYRWOCKSJXLDG-UHFFFAOYSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | methyl 2-[4-[3-(methylcarbamoyl)phenyl]phenyl]acetate |
| InChIKey | OCYRWOCKSJXLDG-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=CC(=C1)C2=CC=C(C=C2)CC(=O)OC |
Computed by PubChem (NCBI)