CAS 1375069-21-8 is the registry number for {4-[3-(Ethylcarbamoyl)phenyl]phenyl}acetic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[4-[3-(ethylcarbamoyl)phenyl]phenyl]acetic acid (CAS 1375069-21-8) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: 2-[4-[3-(ethylcarbamoyl)phenyl]phenyl]acetic acid. InChIKey: DOZVHTQLNZVOFG-UHFFFAOYSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 2-[4-[3-(ethylcarbamoyl)phenyl]phenyl]acetic acid |
| InChIKey | DOZVHTQLNZVOFG-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CC=CC(=C1)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)