cas: 81379-52-4 — see every product listed under this CAS number, including other names
Fmoc-His(Boc)-OH 98% (CAS 81379-52-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A653105-1g |
| cas | 81379-52-4 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1193.62 Pln | |
| Ambeed | 500g | 4609.00 Pln | |
| Ambeed | 1000g | 9148.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A653105 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-4-yl]propanoic acid (CAS 81379-52-4) is a chemical compound with the molecular formula C26H27N3O6 and a molecular weight of 477.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-4-yl]propanoic acid. InChIKey: ZRHPMMZWDWMKPD-QFIPXVFZSA-N.
| Molecular formula | C26H27N3O6 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-4-yl]propanoic acid |
| InChIKey | ZRHPMMZWDWMKPD-QFIPXVFZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(N=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)