cas: 81379-52-4 — see every product listed under this CAS number, including other names
Fmoc-His(Boc)-OH, 95% (CAS 81379-52-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614812-250MG |
| cas | 81379-52-4 |
| size | 250mg |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 227.02 Pln | |
| Fluorochem | 25g | 362.39 Pln | |
| Fluorochem | 100g | 1179.81 Pln | |
| Fluorochem | 500g | 4647.34 Pln | |
| Fluorochem | 1kg | 9046.83 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-4-yl]propanoic acid (CAS 81379-52-4) is a chemical compound with the molecular formula C26H27N3O6 and a molecular weight of 477.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-4-yl]propanoic acid. InChIKey: ZRHPMMZWDWMKPD-QFIPXVFZSA-N.
| Molecular formula | C26H27N3O6 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-4-yl]propanoic acid |
| InChIKey | ZRHPMMZWDWMKPD-QFIPXVFZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(N=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)