CAS 2349795-42-0 is the registry number for Fmoc-HoPhe(4-I)-OH, 98%. Offered by: Ambeed. Available pack sizes: 25mg, 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-iodophenyl)butanoic acid (CAS 2349795-42-0) is a chemical compound with the molecular formula C25H22INO4 and a molecular weight of 527.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-iodophenyl)butanoic acid. InChIKey: BALDQSKRRBIOCD-QHCPKHFHSA-N.
| Molecular formula | C25H22INO4 |
|---|---|
| Molecular weight | 527.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-iodophenyl)butanoic acid |
| InChIKey | BALDQSKRRBIOCD-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC4=CC=C(C=C4)I)C(=O)O |
Computed by PubChem (NCBI)