CAS 2349626-82-8 is the registry number for (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-iodophenyl)butanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 100mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-iodophenyl)butanoic acid (CAS 2349626-82-8) is a chemical compound with the molecular formula C25H22INO4 and a molecular weight of 527.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-iodophenyl)butanoic acid. InChIKey: BALDQSKRRBIOCD-HSZRJFAPSA-N.
| Molecular formula | C25H22INO4 |
|---|---|
| Molecular weight | 527.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-iodophenyl)butanoic acid |
| InChIKey | BALDQSKRRBIOCD-HSZRJFAPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC4=CC=C(C=C4)I)C(=O)O |
Computed by PubChem (NCBI)