CAS 2349317-02-6 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(3-iodophenyl)butanoic acid, ≥95%(210nm), ≥95%(210nm). Offered by: Chemat. Available pack sizes: 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-iodophenyl)butanoic acid (CAS 2349317-02-6) is a chemical compound with the molecular formula C25H22INO4 and a molecular weight of 527.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-iodophenyl)butanoic acid. InChIKey: BUCHHNLSYGUFGF-QHCPKHFHSA-N.
| Molecular formula | C25H22INO4 |
|---|---|
| Molecular weight | 527.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(3-iodophenyl)butanoic acid |
| InChIKey | BUCHHNLSYGUFGF-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC4=CC(=CC=C4)I)C(=O)O |
Computed by PubChem (NCBI)