cas: 88050-17-3 — see every product listed under this CAS number, including other names
Fmoc-Hyp-OH, 99.88% (CAS 88050-17-3) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 25 g, 250 g, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008205-100 g |
| cas | 88050-17-3 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 528.67 Pln | |
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 250 g | 983.78 Pln | |
| MedChemExpress | 500 g | 1606.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.88% |
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid (CAS 88050-17-3) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid. InChIKey: GOUUPUICWUFXPM-XIKOKIGWSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | GOUUPUICWUFXPM-XIKOKIGWSA-N |
| SMILES | C1[C@H](CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)