cas: 198561-04-5 — see every product listed under this CAS number, including other names
Fmoc-L-4-Bromophenylalanine, 99%, 99% (CAS 198561-04-5) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BMM-50g |
| cas | 198561-04-5 |
| size | 50g |
| availability | 999g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 602.00 Pln | |
| Chemat | 250g | 2474.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 179.60 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 100g | 1130.00 Pln | |
| Chemat | 500g | 4612.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 198561-04-5) is a chemical compound with the molecular formula C24H20BrNO4 and a molecular weight of 466.3 g/mol. IUPAC name: (2S)-3-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: TVBAVBWXRDHONF-QFIPXVFZSA-N.
| Molecular formula | C24H20BrNO4 |
|---|---|
| Molecular weight | 466.3 g/mol |
| IUPAC name | (2S)-3-(4-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | TVBAVBWXRDHONF-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)Br)C(=O)O |
Computed by PubChem (NCBI)