CAS 269078-76-4 appears in our catalog under these names: Fmoc–3–amino–3–(4–bromophenyl)propionic acid, Fmoc-DL-β-Phe(4-Br)-OH 95%, 3-N-Fmoc-3-(4-bromophenyl)propionic acid, 96%, 3-N-Fmoc-3-(4-bromophenyl)propionic acid, 95%, 95%, Fmoc-3-amino-3-(4-bromophenyl)propionic acid, 95%. Offered by: GLPBio, Ambeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g.
3-(4-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 269078-76-4) is a chemical compound with the molecular formula C24H20BrNO4 and a molecular weight of 466.3 g/mol. IUPAC name: 3-(4-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: GVCLAQFMSVKNKH-UHFFFAOYSA-N.
| Molecular formula | C24H20BrNO4 |
|---|---|
| Molecular weight | 466.3 g/mol |
| IUPAC name | 3-(4-bromophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | GVCLAQFMSVKNKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)