CAS 220497-47-2 appears in our catalog under these names: Fmoc–Phe(2–Br)–OH, Fmoc-Phe(2-Br)-OH 98%, Fmoc-Phe(2-Br)-OH, 99.79%, Fmoc-Phe(2-Br)-OH, 96%, 2-Bromo-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-phenylalanine, 97%, 97%. Offered by: GLPBio, Ambeed, MedChemExpress, Fluorochem, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 25 g, 5 g, 10 g.
(2S)-3-(2-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 220497-47-2) is a chemical compound with the molecular formula C24H20BrNO4 and a molecular weight of 466.3 g/mol. IUPAC name: (2S)-3-(2-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: GRJPAUULVKPBHU-QFIPXVFZSA-N.
| Molecular formula | C24H20BrNO4 |
|---|---|
| Molecular weight | 466.3 g/mol |
| IUPAC name | (2S)-3-(2-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | GRJPAUULVKPBHU-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Br |
Computed by PubChem (NCBI)