cas: 205526-32-5 — see every product listed under this CAS number, including other names
Fmoc-L-Phe(F5)-OH 98% (CAS 205526-32-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A659963-100mg |
| cas | 205526-32-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1594.12 Pln | |
| Ambeed | 25g | 3841.38 Pln | |
| Ambeed | 100g | 12135.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A659963 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid (CAS 205526-32-5) is a chemical compound with the molecular formula C24H16F5NO4 and a molecular weight of 477.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid. InChIKey: DLOGILOIJKBYKA-KRWDZBQOSA-N.
| Molecular formula | C24H16F5NO4 |
|---|---|
| Molecular weight | 477.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
| InChIKey | DLOGILOIJKBYKA-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=C(C(=C(C(=C4F)F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)