CAS 159631-29-5 appears in our catalog under these names: Perfluorophenyl 2–((((9H–fluoren–9–yl)methoxy)carbonyl)(methyl)amino)acetate, Fmoc-Sar-OPfp, 97.00%, Fmoc-Sar-OPfp, 96%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g, 500g.
(2,3,4,5,6-pentafluorophenyl) 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetate (CAS 159631-29-5) is a chemical compound with the molecular formula C24H16F5NO4 and a molecular weight of 477.4 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetate. InChIKey: PJYXJFOLTCMMLK-UHFFFAOYSA-N.
| Molecular formula | C24H16F5NO4 |
|---|---|
| Molecular weight | 477.4 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetate |
| InChIKey | PJYXJFOLTCMMLK-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)