CAS 86060-86-8 appears in our catalog under these names: Fmoc–Ala–OPfp, Fmoc-L-alanine pentafluorophenyl ester, Fmoc-Ala-Opfp 98%, Fmoc-L-alanine pentafluorophenyl ester, min. 95 %, 5 g, Fmoc-L-alanine pentafluorophenyl ester, min. 95 %, 10 g. Offered by: GLPBio, Biosynth, Ambeed, Roth. Available pack sizes: 25g, 5g, 10g, 50g, 250mg, 1g.
(2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (CAS 86060-86-8) is a chemical compound with the molecular formula C24H16F5NO4 and a molecular weight of 477.4 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate. InChIKey: CJXZXBGKOSXBFR-NSHDSACASA-N.
| Molecular formula | C24H16F5NO4 |
|---|---|
| Molecular weight | 477.4 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| InChIKey | CJXZXBGKOSXBFR-NSHDSACASA-N |
| SMILES | C[C@@H](C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)