cas: 146982-27-6 — see every product listed under this CAS number, including other names
Fmoc-Lys(Alloc)-OH, 99.77% (CAS 146982-27-6) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W010862-25 g |
| cas | 146982-27-6 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 361.49 Pln | |
| MedChemExpress | 100 g | 900.19 Pln | |
| MedChemExpress | 10 g | 240.74 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.77% |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid (CAS 146982-27-6) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid. InChIKey: OJBNDXHENJDCBA-QFIPXVFZSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid |
| InChIKey | OJBNDXHENJDCBA-QFIPXVFZSA-N |
| SMILES | C=CCOC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)