cas: 146982-27-6 — see every product listed under this CAS number, including other names
N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N6-[(2-propen-1-yloxy)carbonyl]-L-lysine, 98%, 98% (CAS 146982-27-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 50g, 100g, 250g, 500g, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145Y4-1g |
| cas | 146982-27-6 |
| size | 1g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 50g | 290.00 Pln | |
| Chemat | 100g | 510.80 Pln | |
| Chemat | 250g | 1130.00 Pln | |
| Chemat | 500g | 2064.00 Pln | |
| Chemat | 5kg | 13756.80 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid (CAS 146982-27-6) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid. InChIKey: OJBNDXHENJDCBA-QFIPXVFZSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid |
| InChIKey | OJBNDXHENJDCBA-QFIPXVFZSA-N |
| SMILES | C=CCOC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)