cas: 146982-27-6 — see every product listed under this CAS number, including other names
Fmoc-Lys(Alloc)-OH, 97% (CAS 146982-27-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M06250-1G |
| cas | 146982-27-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 154.13 Pln | |
| Fluorochem | 25g | 237.43 Pln | |
| Fluorochem | 100g | 789.32 Pln | |
| Fluorochem | 500g | 3704.96 Pln | |
| Fluorochem | 1kg | 7323.48 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid (CAS 146982-27-6) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid. InChIKey: OJBNDXHENJDCBA-QFIPXVFZSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid |
| InChIKey | OJBNDXHENJDCBA-QFIPXVFZSA-N |
| SMILES | C=CCOC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)