cas: 2138482-09-2 — see every product listed under this CAS number, including other names
Fmoc-N-Me-3-(2-Naphthyl)-Ala-OH 95% (CAS 2138482-09-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A670172-100mg |
| cas | 2138482-09-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 370.38 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 965.56 Pln | |
| Ambeed | 5g | 2762.25 Pln | |
| Ambeed | 10g | 5309.88 Pln | |
| Ambeed | 25g | 12040.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A670172 |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-2-ylpropanoic acid (CAS 2138482-09-2) is a chemical compound with the molecular formula C29H25NO4 and a molecular weight of 451.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-2-ylpropanoic acid. InChIKey: OVNHOSZZFGJIPG-MHZLTWQESA-N.
| Molecular formula | C29H25NO4 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-2-ylpropanoic acid |
| InChIKey | OVNHOSZZFGJIPG-MHZLTWQESA-N |
| SMILES | CN([C@@H](CC1=CC2=CC=CC=C2C=C1)C(=O)O)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)