cas: 2138482-09-2 — see every product listed under this CAS number, including other names
N-Fmoc-N-methyl-3-(2-naphthyl)-L-alanine, 98%, 98% (CAS 2138482-09-2) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FP7W-50g |
| cas | 2138482-09-2 |
| size | 50g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 5517.20 Pln | |
| Chemat | 100g | 8915.60 Pln | |
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 746.00 Pln | |
| Chemat | 5g | 2099.60 Pln | |
| Chemat | 10g | 3506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-2-ylpropanoic acid (CAS 2138482-09-2) is a chemical compound with the molecular formula C29H25NO4 and a molecular weight of 451.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-2-ylpropanoic acid. InChIKey: OVNHOSZZFGJIPG-MHZLTWQESA-N.
| Molecular formula | C29H25NO4 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-2-ylpropanoic acid |
| InChIKey | OVNHOSZZFGJIPG-MHZLTWQESA-N |
| SMILES | CN([C@@H](CC1=CC2=CC=CC=C2C=C1)C(=O)O)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)