CAS 270063-38-2 appears in our catalog under these names: Fmoc-(s)-3-amino-4-(1-naphthyl)-butyric acid, 95%, FMOC-(S)-3-AMINO-4-(1-NAPHTHYL)-BUTYRIC ACID, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-naphthalen-1-ylbutanoic acid (CAS 270063-38-2) is a chemical compound with the molecular formula C29H25NO4 and a molecular weight of 451.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-naphthalen-1-ylbutanoic acid. InChIKey: QKDVUQGMQTZWKV-NRFANRHFSA-N.
| Molecular formula | C29H25NO4 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-naphthalen-1-ylbutanoic acid |
| InChIKey | QKDVUQGMQTZWKV-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C[C@@H](CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)