cas: 138775-22-1 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Ile-OH, 98%, 98% (CAS 138775-22-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1120JU-1g |
| cas | 138775-22-1 |
| size | 1g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 232.40 Pln | |
| Chemat | 50g | 390.80 Pln | |
| Chemat | 100g | 717.20 Pln | |
| Chemat | 250g | 1614.80 Pln | |
| Chemat | 500g | 3201.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,3S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid (CAS 138775-22-1) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: (2S,3S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid. InChIKey: IQIOLCJHRZWOLS-XOBRGWDASA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2S,3S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylpentanoic acid |
| InChIKey | IQIOLCJHRZWOLS-XOBRGWDASA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)