cas: 103478-62-2 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Leu-OH, 99.72% (CAS 103478-62-2) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 500 g, 100 g, 1 g, 25 g, 10 g, 250 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008558-50 g |
| cas | 103478-62-2 |
| size | 50 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 1141.68 Pln | |
| MedChemExpress | 500 g | 4726.85 Pln | |
| MedChemExpress | 100 g | 1657.16 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 25 g | 793.38 Pln | |
| MedChemExpress | 10 g | 454.37 Pln | |
| MedChemExpress | 250 g | 3189.68 Pln | |
| MedChemExpress | 5 g | 333.62 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.72% |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylpentanoic acid (CAS 103478-62-2) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylpentanoic acid. InChIKey: BUJQSIPFDWLNDC-FQEVSTJZSA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylpentanoic acid |
| InChIKey | BUJQSIPFDWLNDC-FQEVSTJZSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)