cas: 197632-77-2 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Ser(tBu)-OH, 97% (CAS 197632-77-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | M03385-250MG |
| cas | 197632-77-2 |
| size | 250mg |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 10g | 773.70 Pln | |
| Fluorochem | 25g | 1835.83 Pln | |
| Fluorochem | 100g | 5683.43 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 414.88 Pln | |
| Ambeed | 25g | 1783.25 Pln | |
| Ambeed | 100g | 5554.62 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid (CAS 197632-77-2) is a chemical compound with the molecular formula C23H27NO5 and a molecular weight of 397.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid. InChIKey: PQSAXALAXPNFMG-FQEVSTJZSA-N.
| Molecular formula | C23H27NO5 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| InChIKey | PQSAXALAXPNFMG-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)