cas: 197632-77-2 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Ser(tBu)-OH, 98%, 98% (CAS 197632-77-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250g, 500g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AWX-10g |
| cas | 197632-77-2 |
| size | 10g |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 779.60 Pln | |
| Chemat | 250g | 8915.60 Pln | |
| Chemat | 500g | 14745.60 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 424.40 Pln | |
| Chemat | 25g | 1821.20 Pln | |
| Chemat | 50g | 3165.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid (CAS 197632-77-2) is a chemical compound with the molecular formula C23H27NO5 and a molecular weight of 397.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid. InChIKey: PQSAXALAXPNFMG-FQEVSTJZSA-N.
| Molecular formula | C23H27NO5 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| InChIKey | PQSAXALAXPNFMG-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)