cas: 158922-07-7 — see every product listed under this CAS number, including other names
Fmoc-NIP-OH, 99.00% (CAS 158922-07-7) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 1 g, 5 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W088805-10 g |
| cas | 158922-07-7 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 468.30 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 5 g | 342.91 Pln | |
| MedChemExpress | 25 g | 821.24 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.00% |
1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid (CAS 158922-07-7) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid. InChIKey: FINXGQXNIBNREL-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid |
| InChIKey | FINXGQXNIBNREL-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)