cas: 193885-59-5 — see every product listed under this CAS number, including other names
Fmoc-Octyl-Gly-OH 95% (CAS 193885-59-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A327689-250mg |
| cas | 193885-59-5 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 10g | 476.06 Pln | |
| Ambeed | 25g | 1082.38 Pln | |
| Ambeed | 100g | 3307.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A327689 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)decanoic acid (CAS 193885-59-5) is a chemical compound with the molecular formula C25H31NO4 and a molecular weight of 409.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)decanoic acid. InChIKey: LSMLSLHVRMSYPT-QHCPKHFHSA-N.
| Molecular formula | C25H31NO4 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)decanoic acid |
| InChIKey | LSMLSLHVRMSYPT-QHCPKHFHSA-N |
| SMILES | CCCCCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)