Products 1817838-91-7
CAS 1817838-91-7 appears in our catalog under these names: Sacubitril Impurity 21, Valsartan Impurity 103, Sacubitril Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (E,4R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pent-2-enoate (CAS 1817838-91-7) is a chemical compound with the molecular formula C25H31NO4 and a molecular weight of 409.5 g/mol. IUPAC name: ethyl (E,4R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pent-2-enoate. InChIKey: QOCQMJHAWNNWAV-BKELBIJQSA-N.
| Molecular formula | C25H31NO4 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | ethyl (E,4R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pent-2-enoate |
| InChIKey | QOCQMJHAWNNWAV-BKELBIJQSA-N |
| SMILES | CCOC(=O)/C(=C/[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)OC(C)(C)C)/C |
Computed by PubChem (NCBI)