CAS 201216-39-9 appears in our catalog under these names: 4-PPBP maleate, 98%, 4-PPBP maleate/ 99.54% (existing batch purity), 4–PPBP maleate, 4-Ppbp maleate, 4-PPBP maleate 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg, 10 mg.
(Z)-but-2-enedioic acid;4-phenyl-1-(4-phenylbutyl)piperidine (CAS 201216-39-9) is a chemical compound with the molecular formula C25H31NO4 and a molecular weight of 409.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;4-phenyl-1-(4-phenylbutyl)piperidine. InChIKey: OASPNIMFGJVLES-BTJKTKAUSA-N.
| Molecular formula | C25H31NO4 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;4-phenyl-1-(4-phenylbutyl)piperidine |
| InChIKey | OASPNIMFGJVLES-BTJKTKAUSA-N |
| SMILES | C1CN(CCC1C2=CC=CC=C2)CCCCC3=CC=CC=C3.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)