cas: 1314378-14-7 — see every product listed under this CAS number, including other names
Fmoc-PEG4-NHS ester 95% (CAS 1314378-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A839313-100mg |
| cas | 1314378-14-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1816.62 Pln | |
| Ambeed | 25g | 8397.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A839313 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1314378-14-7) is a chemical compound with the molecular formula C30H36N2O10 and a molecular weight of 584.6 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: NMCTTZZPHFQEQB-UHFFFAOYSA-N.
| Molecular formula | C30H36N2O10 |
|---|---|
| Molecular weight | 584.6 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | NMCTTZZPHFQEQB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)