Fmoc-PEG4-NHS ester, 98%, 98%
cas: 1314378-14-7 — see every product listed under this CAS number, including other names
Fmoc-PEG4-NHS ester, 98%, 98% (CAS 1314378-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HSGN-100mg |
| cas | 1314378-14-7 |
| size | 100mg |
| availability | 250g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1576.40 Pln | |
| Chemat | 25g | 3165.20 Pln | |
| Chemat | 50g | 3952.40 Pln | |
| Chemat | 100g | 4518.80 Pln | |
| Chemat | 250g | 6957.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1314378-14-7) is a chemical compound with the molecular formula C30H36N2O10 and a molecular weight of 584.6 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: NMCTTZZPHFQEQB-UHFFFAOYSA-N.
| Molecular formula | C30H36N2O10 |
|---|---|
| Molecular weight | 584.6 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | NMCTTZZPHFQEQB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)