cas: 204320-45-6 — see every product listed under this CAS number, including other names
Fmoc-trans-3-phenylazetidine-2-carboxylicacid 96% (HPLC) (CAS 204320-45-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A439412-50mg |
| cas | 204320-45-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 565.06 Pln | |
| Ambeed | 100mg | 815.38 Pln | |
| Ambeed | 250mg | 1560.75 Pln | |
| Ambeed | 1g | 4558.94 Pln |
| purity | 96% (HPLC) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A439412 |
1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid (CAS 204320-45-6) is a chemical compound with the molecular formula C25H21NO4 and a molecular weight of 399.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid. InChIKey: SQMOPSBYDIMJRP-UHFFFAOYSA-N.
| Molecular formula | C25H21NO4 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid |
| InChIKey | SQMOPSBYDIMJRP-UHFFFAOYSA-N |
| SMILES | C1C(C(N1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)