cas: 204320-45-6 — see every product listed under this CAS number, including other names
Racemic Fmoc-trans-3-phenylazetidine-2-carboxylic acid, 96% (CAS 204320-45-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F492809-100MG |
| cas | 204320-45-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1965.99 Pln | |
| Fluorochem | 250mg | 3439.43 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid (CAS 204320-45-6) is a chemical compound with the molecular formula C25H21NO4 and a molecular weight of 399.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid. InChIKey: SQMOPSBYDIMJRP-UHFFFAOYSA-N.
| Molecular formula | C25H21NO4 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid |
| InChIKey | SQMOPSBYDIMJRP-UHFFFAOYSA-N |
| SMILES | C1C(C(N1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)