CAS 221352-88-1 appears in our catalog under these names: Fmoc-2-(2-aminoethoxy)-ethylamine hydrochloride, 96%, 2-(2-(Fmoc-amino)ethoxy)ethylamine Hydrochloride, 2–(2–(Fmoc–amino)ethoxy)ethylamine hydrochloride, (9H-Fluoren-9-yl)methyl (2-(2-aminoethoxy)ethyl)carbamate hydrochloride, 96%, 96%, Fmoc-2-(2-aminoethoxy)-ethylamine hydrochloride, 98%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 2,5g, 250mg, 100mg.
9H-fluoren-9-ylmethyl N-[2-(2-aminoethoxy)ethyl]carbamate;hydrochloride (CAS 221352-88-1) is a chemical compound with the molecular formula C19H23ClN2O3 and a molecular weight of 362.8 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[2-(2-aminoethoxy)ethyl]carbamate;hydrochloride. InChIKey: ZRXOWZYREIYUHG-UHFFFAOYSA-N.
| Molecular formula | C19H23ClN2O3 |
|---|---|
| Molecular weight | 362.8 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[2-(2-aminoethoxy)ethyl]carbamate;hydrochloride |
| InChIKey | ZRXOWZYREIYUHG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCN.Cl |
Computed by PubChem (NCBI)