CAS 38017-65-1 appears in our catalog under these names: H-Phe-Phe-OMe.HCl 97%, H-Phe-PHE-OMe.HCl, 96%, 96%, Phe-Phe-OMe·HCl, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
Methyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoate;hydrochloride (CAS 38017-65-1) is a chemical compound with the molecular formula C19H23ClN2O3 and a molecular weight of 362.8 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoate;hydrochloride. InChIKey: CVAWZIWMXQMICB-QJHJCNPRSA-N.
| Molecular formula | C19H23ClN2O3 |
|---|---|
| Molecular weight | 362.8 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoate;hydrochloride |
| InChIKey | CVAWZIWMXQMICB-QJHJCNPRSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)