CAS 96441-14-4 appears in our catalog under these names: Labetalone hydrochloride, 95%, Labetalol EP Impurity F HCl, Labetalol Hydrochloride Impurity 6 (Labetalol Hydrochloride EP Impurity F), rac-Keto Labetalol Hydrochloride (~90%), >95% (HPLC), Labetalone hydrochloride/ 99.06% (existing batch purity). Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, TargetMol. Available pack sizes: 100mg, on request, 10mg, 25mg, 50mg, 200mg, 500mg, 5mg.
2-hydroxy-5-[2-(4-phenylbutan-2-ylamino)acetyl]benzamide;hydrochloride (CAS 96441-14-4) is a chemical compound with the molecular formula C19H23ClN2O3 and a molecular weight of 362.8 g/mol. IUPAC name: 2-hydroxy-5-[2-(4-phenylbutan-2-ylamino)acetyl]benzamide;hydrochloride. InChIKey: DJHFVUYXWAEVRA-UHFFFAOYSA-N.
| Molecular formula | C19H23ClN2O3 |
|---|---|
| Molecular weight | 362.8 g/mol |
| IUPAC name | 2-hydroxy-5-[2-(4-phenylbutan-2-ylamino)acetyl]benzamide;hydrochloride |
| InChIKey | DJHFVUYXWAEVRA-UHFFFAOYSA-N |
| SMILES | CC(CCC1=CC=CC=C1)NCC(=O)C2=CC(=C(C=C2)O)C(=O)N.Cl |
Computed by PubChem (NCBI)