Products 2457232-14-1
CAS 2457232-14-1 appears in our catalog under these names: G6PDi–1, G6PDI-1, G6PDi-1 99%, G6PDi-1, 99.53%, G6PDi-1/ 98.69% (existing batch purity). Offered by: GLPBio, Biosynth, Ambeed, MedChemExpress, TargetMol. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, 10mM/1mL.
4-[(5-oxo-6,7,8,9-tetrahydrocyclohepta[d]pyrimidin-2-yl)amino]thiophene-2-carbonitrile (CAS 2457232-14-1) is a chemical compound with the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. IUPAC name: 4-[(5-oxo-6,7,8,9-tetrahydrocyclohepta[d]pyrimidin-2-yl)amino]thiophene-2-carbonitrile. InChIKey: USWCHVCZOGGQQA-UHFFFAOYSA-N.
| Molecular formula | C14H12N4OS |
|---|---|
| Molecular weight | 284.34 g/mol |
| IUPAC name | 4-[(5-oxo-6,7,8,9-tetrahydrocyclohepta[d]pyrimidin-2-yl)amino]thiophene-2-carbonitrile |
| InChIKey | USWCHVCZOGGQQA-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C2=CN=C(N=C2C1)NC3=CSC(=C3)C#N |
Computed by PubChem (NCBI)