cas: 186452-09-5 — see every product listed under this CAS number, including other names
GPI-1046 99% (CAS 186452-09-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A711280-1mg |
| cas | 186452-09-5 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 320.31 Pln | |
| Ambeed | 5mg | 442.69 Pln | |
| Ambeed | 10mg | 626.25 Pln | |
| Ambeed | 25mg | 898.81 Pln | |
| Ambeed | 50mg | 1488.44 Pln | |
| Ambeed | 100mg | 2478.56 Pln | |
| Ambeed | 250mg | 4158.44 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A711280 |
3-pyridin-3-ylpropyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate (CAS 186452-09-5) is a chemical compound with the molecular formula C20H28N2O4 and a molecular weight of 360.4 g/mol. IUPAC name: 3-pyridin-3-ylpropyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate. InChIKey: OQAHHWOPVDDWHD-INIZCTEOSA-N.
| Molecular formula | C20H28N2O4 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 3-pyridin-3-ylpropyl (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
| InChIKey | OQAHHWOPVDDWHD-INIZCTEOSA-N |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC[C@H]1C(=O)OCCCC2=CN=CC=C2 |
Computed by PubChem (NCBI)