Products 1936016-59-9

CAS 1936016-59-9 appears in our catalog under these names: 1,7-Diaza-spiro[3.5]nonane-1,7-dicarboxylic acid 7-benzyl ester 1-tert-butyl ester, 95%, 1,7-diazaspiro[3.5]nonane-1,7-dicarboxylic acid 7-benzyl ester 1-tert-butyl ester, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

7-O-benzyl 1-O-tert-butyl 1,7-diazaspiro[3.5]nonane-1,7-dicarboxylate (CAS 1936016-59-9) is a chemical compound with the molecular formula C20H28N2O4 and a molecular weight of 360.4 g/mol. IUPAC name: 7-O-benzyl 1-O-tert-butyl 1,7-diazaspiro[3.5]nonane-1,7-dicarboxylate. InChIKey: FJWJGUPMZQPENQ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H28N2O4
Molecular weight360.4 g/mol
IUPAC name7-O-benzyl 1-O-tert-butyl 1,7-diazaspiro[3.5]nonane-1,7-dicarboxylate
InChIKeyFJWJGUPMZQPENQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC12CCN(CC2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)