Products 1643854-06-1
CAS 1643854-06-1 is the registry number for (S)-1-(1-Carboxy-3-methylbutyl)-3-mesityl-1H-imidazol-3-ium acetate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-4-methyl-2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]pentanoic acid acetate (CAS 1643854-06-1) is a chemical compound with the molecular formula C20H28N2O4 and a molecular weight of 360.4 g/mol. IUPAC name: (2S)-4-methyl-2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]pentanoic acid acetate. InChIKey: YBWNKPOTBMJEEY-NTISSMGPSA-N.
| Molecular formula | C20H28N2O4 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | (2S)-4-methyl-2-[3-(2,4,6-trimethylphenyl)imidazol-1-ium-1-yl]pentanoic acid acetate |
| InChIKey | YBWNKPOTBMJEEY-NTISSMGPSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)[C@@H](CC(C)C)C(=O)O)C.CC(=O)[O-] |
Computed by PubChem (NCBI)